C41H60O4SSi2 — CID 10628534
[(3S,4E,8E)-6-(benzenesulfonyl)-10-[tert-butyl(dimethyl)silyl]oxy-3,4,8-trimethyldeca-4,8-dienoxy]-tert-butyl-diphenylsilane (PubChem CID 10628534) has the molecular formula C41H60O4SSi2 and a molecular weight of 705.17 g/mol. Its IUPAC name is [(3S,4E,8E)-6-(benzenesulfonyl)-10-[tert-butyl(dimethyl)silyl]oxy-3,4,8-trimethyldeca-4,8-dienoxy]-tert-butyl-diphenylsilane.
| Compound Name | [(3S,4E,8E)-6-(benzenesulfonyl)-10-[tert-butyl(dimethyl)silyl]oxy-3,4,8-trimethyldeca-4,8-dienoxy]-tert-butyl-diphenylsilane |
|---|---|
| PubChem CID | 10628534 |
| Molecular Formula | C41H60O4SSi2 |
| Molecular Weight | 705.17 g/mol |
| Exact Mass | 704.38 |
| IUPAC Name | [(3S,4E,8E)-6-(benzenesulfonyl)-10-[tert-butyl(dimethyl)silyl]oxy-3,4,8-trimethyldeca-4,8-dienoxy]-tert-butyl-diphenylsilane |
| SMILES | C/C(=C\CO[Si](C)(C)C(C)(C)C)CC(/C=C(\C)[C@@H](C)CCO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C41H60O4SSi2/c1-33(27-29-44-47(10,11)40(4,5)6)31-37(46(42,43)36-21-15-12-16-22-36)32-35(3)34(2)28-30-45-48(41(7,8)9,38-23-17-13-18-24-38)39-25-19-14-20-26-39/h12-27,32,34,37H,28-31H2,1-11H3/b33-27+,35-32+/t34-,37?/m0/s1 |
| InChIKey | PCQNMSNWDURFGG-YHQUAJNJSA-N |
| XLogP | 9.74 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 705.17 |
| LogP ≤ 5 | 9.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|