C33H41BrN2O8S — CID 10628536
3-[2-[2-(2-bromophenyl)sulfanylethoxy]-3-methoxy-5-[(2S,5S)-5-(3,4,5-trimethoxyphenyl)oxolan-2-yl]phenyl]-1-butyl-1-hydroxyurea (PubChem CID 10628536) has the molecular formula C33H41BrN2O8S and a molecular weight of 705.67 g/mol. Its IUPAC name is 3-[2-[2-(2-bromophenyl)sulfanylethoxy]-3-methoxy-5-[(2S,5S)-5-(3,4,5-trimethoxyphenyl)oxolan-2-yl]phenyl]-1-butyl-1-hydroxyurea.
| Compound Name | 3-[2-[2-(2-bromophenyl)sulfanylethoxy]-3-methoxy-5-[(2S,5S)-5-(3,4,5-trimethoxyphenyl)oxolan-2-yl]phenyl]-1-butyl-1-hydroxyurea |
|---|---|
| PubChem CID | 10628536 |
| Molecular Formula | C33H41BrN2O8S |
| Molecular Weight | 705.67 g/mol |
| Exact Mass | 704.18 |
| IUPAC Name | 3-[2-[2-(2-bromophenyl)sulfanylethoxy]-3-methoxy-5-[(2S,5S)-5-(3,4,5-trimethoxyphenyl)oxolan-2-yl]phenyl]-1-butyl-1-hydroxyurea |
| SMILES | CCCCN(O)C(=O)Nc1cc([C@@H]2CC[C@@H](c3cc(OC)c(OC)c(OC)c3)O2)cc(OC)c1OCCSc1ccccc1Br |
| InChI | InChI=1S/C33H41BrN2O8S/c1-6-7-14-36(38)33(37)35-24-17-21(18-27(39-2)31(24)43-15-16-45-30-11-9-8-10-23(30)34)25-12-13-26(44-25)22-19-28(40-3)32(42-5)29(20-22)41-4/h8-11,17-20,25-26,38H,6-7,12-16H2,1-5H3,(H,35,37)/t25-,26-/m0/s1 |
| InChIKey | ADGAICNUKKFKGZ-UIOOFZCWSA-N |
| XLogP | 8.27 |
| TPSA | 107.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 705.67 |
| LogP ≤ 5 | 8.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|