C11H21ClF3NO — CID 106286607
2-chloro-3-ethyl-N-[2-(2,2,2-trifluoroethoxy)ethyl]pentan-1-amine (PubChem CID 106286607) has the molecular formula C11H21ClF3NO and a molecular weight of 275.74 g/mol. Its IUPAC name is 2-chloro-3-ethyl-N-[2-(2,2,2-trifluoroethoxy)ethyl]pentan-1-amine.
| Compound Name | 2-chloro-3-ethyl-N-[2-(2,2,2-trifluoroethoxy)ethyl]pentan-1-amine |
|---|---|
| PubChem CID | 106286607 |
| Molecular Formula | C11H21ClF3NO |
| Molecular Weight | 275.74 g/mol |
| Exact Mass | 275.13 |
| IUPAC Name | 2-chloro-3-ethyl-N-[2-(2,2,2-trifluoroethoxy)ethyl]pentan-1-amine |
| SMILES | CCC(CC)C(Cl)CNCCOCC(F)(F)F |
| InChI | InChI=1S/C11H21ClF3NO/c1-3-9(4-2)10(12)7-16-5-6-17-8-11(13,14)15/h9-10,16H,3-8H2,1-2H3 |
| InChIKey | NZAKUSRKQZADPQ-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.74 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|