C16H34N2O2 — CID 106286630
4-(2-aminoethyl)-N-(3-ethyl-2-hydroxypentyl)heptanamide (PubChem CID 106286630) has the molecular formula C16H34N2O2 and a molecular weight of 286.46 g/mol. Its IUPAC name is 4-(2-aminoethyl)-N-(3-ethyl-2-hydroxypentyl)heptanamide.
| Compound Name | 4-(2-aminoethyl)-N-(3-ethyl-2-hydroxypentyl)heptanamide |
|---|---|
| PubChem CID | 106286630 |
| Molecular Formula | C16H34N2O2 |
| Molecular Weight | 286.46 g/mol |
| Exact Mass | 286.26 |
| IUPAC Name | 4-(2-aminoethyl)-N-(3-ethyl-2-hydroxypentyl)heptanamide |
| SMILES | CCCC(CCN)CCC(=O)NCC(O)C(CC)CC |
| InChI | InChI=1S/C16H34N2O2/c1-4-7-13(10-11-17)8-9-16(20)18-12-15(19)14(5-2)6-3/h13-15,19H,4-12,17H2,1-3H3,(H,18,20) |
| InChIKey | BOVBOCHUVOCEAB-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.46 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |