C10H23N3O2S — CID 106286684
1-N-(cyclopropylsulfamoyl)-3-ethylpentane-1,2-diamine (PubChem CID 106286684) has the molecular formula C10H23N3O2S and a molecular weight of 249.38 g/mol. Its IUPAC name is 1-N-(cyclopropylsulfamoyl)-3-ethylpentane-1,2-diamine.
| Compound Name | 1-N-(cyclopropylsulfamoyl)-3-ethylpentane-1,2-diamine |
|---|---|
| PubChem CID | 106286684 |
| Molecular Formula | C10H23N3O2S |
| Molecular Weight | 249.38 g/mol |
| Exact Mass | 249.15 |
| IUPAC Name | 1-N-(cyclopropylsulfamoyl)-3-ethylpentane-1,2-diamine |
| SMILES | CCC(CC)C(N)CNS(=O)(=O)NC1CC1 |
| InChI | InChI=1S/C10H23N3O2S/c1-3-8(4-2)10(11)7-12-16(14,15)13-9-5-6-9/h8-10,12-13H,3-7,11H2,1-2H3 |
| InChIKey | HEADBCMTPUKBOM-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.38 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |