C15H22N4 — CID 106286875
3-ethyl-1-N-quinazolin-4-ylpentane-1,2-diamine (PubChem CID 106286875) has the molecular formula C15H22N4 and a molecular weight of 258.37 g/mol. Its IUPAC name is 3-ethyl-1-N-quinazolin-4-ylpentane-1,2-diamine.
| Compound Name | 3-ethyl-1-N-quinazolin-4-ylpentane-1,2-diamine |
|---|---|
| PubChem CID | 106286875 |
| Molecular Formula | C15H22N4 |
| Molecular Weight | 258.37 g/mol |
| Exact Mass | 258.18 |
| IUPAC Name | 3-ethyl-1-N-quinazolin-4-ylpentane-1,2-diamine |
| SMILES | CCC(CC)C(N)CNc1ncnc2ccccc12 |
| InChI | InChI=1S/C15H22N4/c1-3-11(4-2)13(16)9-17-15-12-7-5-6-8-14(12)18-10-19-15/h5-8,10-11,13H,3-4,9,16H2,1-2H3,(H,17,18,19) |
| InChIKey | KOANBPSYLUXMCE-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.37 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |