C14H21ClN4 — CID 106286878
N-(2-chloro-3-ethylpentyl)-7-methyl-[1,2,4]triazolo[1,5-a]pyridin-5-amine (PubChem CID 106286878) has the molecular formula C14H21ClN4 and a molecular weight of 280.80 g/mol. Its IUPAC name is N-(2-chloro-3-ethylpentyl)-7-methyl-[1,2,4]triazolo[1,5-a]pyridin-5-amine.
| Compound Name | N-(2-chloro-3-ethylpentyl)-7-methyl-[1,2,4]triazolo[1,5-a]pyridin-5-amine |
|---|---|
| PubChem CID | 106286878 |
| Molecular Formula | C14H21ClN4 |
| Molecular Weight | 280.80 g/mol |
| Exact Mass | 280.15 |
| IUPAC Name | N-(2-chloro-3-ethylpentyl)-7-methyl-[1,2,4]triazolo[1,5-a]pyridin-5-amine |
| SMILES | CCC(CC)C(Cl)CNc1cc(C)cc2ncnn12 |
| InChI | InChI=1S/C14H21ClN4/c1-4-11(5-2)12(15)8-16-13-6-10(3)7-14-17-9-18-19(13)14/h6-7,9,11-12,16H,4-5,8H2,1-3H3 |
| InChIKey | CGQMXDCBGZBMSA-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 42.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.80 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|