C11H18ClN3 — CID 106286880
N-(2-chloro-3-ethylpentyl)pyrimidin-4-amine (PubChem CID 106286880) has the molecular formula C11H18ClN3 and a molecular weight of 227.74 g/mol. Its IUPAC name is N-(2-chloro-3-ethylpentyl)pyrimidin-4-amine.
| Compound Name | N-(2-chloro-3-ethylpentyl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 106286880 |
| Molecular Formula | C11H18ClN3 |
| Molecular Weight | 227.74 g/mol |
| Exact Mass | 227.12 |
| IUPAC Name | N-(2-chloro-3-ethylpentyl)pyrimidin-4-amine |
| SMILES | CCC(CC)C(Cl)CNc1ccncn1 |
| InChI | InChI=1S/C11H18ClN3/c1-3-9(4-2)10(12)7-14-11-5-6-13-8-15-11/h5-6,8-10H,3-4,7H2,1-2H3,(H,13,14,15) |
| InChIKey | YKBNYWOHZNKAKG-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.74 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|