About 3-ethyl-1-N-(3-methyl-4-pyridinyl)pentane-1,2-diamine
3-ethyl-1-N-(3-methyl-4-pyridinyl)pentane-1,2-diamine (PubChem CID 106287078) has the molecular formula C13H23N3
and a molecular weight of 221.35 g/mol. Its IUPAC name is 3-ethyl-1-N-(3-methyl-4-pyridinyl)pentane-1,2-diamine.
Molecular Properties
| Compound Name | 3-ethyl-1-N-(3-methyl-4-pyridinyl)pentane-1,2-diamine |
| PubChem CID | 106287078 |
| Molecular Formula | C13H23N3 |
| Molecular Weight | 221.35 g/mol |
| Exact Mass | 221.19 |
| IUPAC Name | 3-ethyl-1-N-(3-methyl-4-pyridinyl)pentane-1,2-diamine |
| SMILES | CCC(CC)C(N)CNc1ccncc1C |
| InChI | InChI=1S/C13H23N3/c1-4-11(5-2)12(14)9-16-13-6-7-15-8-10(13)3/h6-8,11-12H,4-5,9,14H2,1-3H3,(H,15,16) |
| InChIKey | UIIADAPUZKFENP-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.35 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-ethyl-1-N-(3-methyl-4-pyridinyl)pentane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethyl-1-N-(3-methyl-4-pyridinyl)pentane-1,2-diamine?
The IUPAC name of 3-ethyl-1-N-(3-methyl-4-pyridinyl)pentane-1,2-diamine (CID 106287078) is 3-ethyl-1-N-(3-methyl-4-pyridinyl)pentane-1,2-diamine.
What is the SMILES notation for 3-ethyl-1-N-(3-methyl-4-pyridinyl)pentane-1,2-diamine?
The canonical SMILES for 3-ethyl-1-N-(3-methyl-4-pyridinyl)pentane-1,2-diamine is CCC(CC)C(N)CNc1ccncc1C.
What is the InChIKey of 3-ethyl-1-N-(3-methyl-4-pyridinyl)pentane-1,2-diamine?
The InChIKey is UIIADAPUZKFENP-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H23N3/c1-4-11(5-2)12(14)9-16-13-6-7-15-8-10(13)3/h6-8,11-12H,4-5,9,14H2,1-3H3,(H,15,16).
What are the key properties of 3-ethyl-1-N-(3-methyl-4-pyridinyl)pentane-1,2-diamine?
3-ethyl-1-N-(3-methyl-4-pyridinyl)pentane-1,2-diamine has a molecular weight of 221.35 g/mol, XLogP of 2.57, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethyl-1-N-(3-methyl-4-pyridinyl)pentane-1,2-diamine is sourced from PubChem (CID 106287078), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).