C13H23N3 — CID 106287078
3-ethyl-1-N-(3-methyl-4-pyridinyl)pentane-1,2-diamine (PubChem CID 106287078) has the molecular formula C13H23N3 and a molecular weight of 221.35 g/mol. Its IUPAC name is 3-ethyl-1-N-(3-methyl-4-pyridinyl)pentane-1,2-diamine.
| Compound Name | 3-ethyl-1-N-(3-methyl-4-pyridinyl)pentane-1,2-diamine |
|---|---|
| PubChem CID | 106287078 |
| Molecular Formula | C13H23N3 |
| Molecular Weight | 221.35 g/mol |
| Exact Mass | 221.19 |
| IUPAC Name | 3-ethyl-1-N-(3-methyl-4-pyridinyl)pentane-1,2-diamine |
| SMILES | CCC(CC)C(N)CNc1ccncc1C |
| InChI | InChI=1S/C13H23N3/c1-4-11(5-2)12(14)9-16-13-6-7-15-8-10(13)3/h6-8,11-12H,4-5,9,14H2,1-3H3,(H,15,16) |
| InChIKey | UIIADAPUZKFENP-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.35 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |