C14H18BrClFNO — CID 106287681
2-bromo-N-(2-chloro-3-ethylpentyl)-3-fluorobenzamide (PubChem CID 106287681) has the molecular formula C14H18BrClFNO and a molecular weight of 350.66 g/mol. Its IUPAC name is 2-bromo-N-(2-chloro-3-ethylpentyl)-3-fluorobenzamide.
| Compound Name | 2-bromo-N-(2-chloro-3-ethylpentyl)-3-fluorobenzamide |
|---|---|
| PubChem CID | 106287681 |
| Molecular Formula | C14H18BrClFNO |
| Molecular Weight | 350.66 g/mol |
| Exact Mass | 349.02 |
| IUPAC Name | 2-bromo-N-(2-chloro-3-ethylpentyl)-3-fluorobenzamide |
| SMILES | CCC(CC)C(Cl)CNC(=O)c1cccc(F)c1Br |
| InChI | InChI=1S/C14H18BrClFNO/c1-3-9(4-2)11(16)8-18-14(19)10-6-5-7-12(17)13(10)15/h5-7,9,11H,3-4,8H2,1-2H3,(H,18,19) |
| InChIKey | LULYMECNDVUVDG-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.66 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|