C15H21BrClNO2 — CID 106288395
N-(2-bromo-3-ethylpentyl)-2-(3-chlorophenoxy)acetamide (PubChem CID 106288395) has the molecular formula C15H21BrClNO2 and a molecular weight of 362.70 g/mol. Its IUPAC name is N-(2-bromo-3-ethylpentyl)-2-(3-chlorophenoxy)acetamide.
| Compound Name | N-(2-bromo-3-ethylpentyl)-2-(3-chlorophenoxy)acetamide |
|---|---|
| PubChem CID | 106288395 |
| Molecular Formula | C15H21BrClNO2 |
| Molecular Weight | 362.70 g/mol |
| Exact Mass | 361.04 |
| IUPAC Name | N-(2-bromo-3-ethylpentyl)-2-(3-chlorophenoxy)acetamide |
| SMILES | CCC(CC)C(Br)CNC(=O)COc1cccc(Cl)c1 |
| InChI | InChI=1S/C15H21BrClNO2/c1-3-11(4-2)14(16)9-18-15(19)10-20-13-7-5-6-12(17)8-13/h5-8,11,14H,3-4,9-10H2,1-2H3,(H,18,19) |
| InChIKey | JFWGWBPHMLYQRA-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.70 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|