C34H28F5IN2O2Si — CID 10628847
[5-[[5-[hydroxy-(4-iodophenyl)methyl]-1H-pyrrol-2-yl]-(2,3,4,5,6-pentafluorophenyl)methyl]-1H-pyrrol-2-yl]-[4-(2-trimethylsilylethynyl)phenyl]methanol (PubChem CID 10628847) has the molecular formula C34H28F5IN2O2Si and a molecular weight of 746.59 g/mol. Its IUPAC name is [5-[[5-[hydroxy-(4-iodophenyl)methyl]-1H-pyrrol-2-yl]-(2,3,4,5,6-pentafluorophenyl)methyl]-1H-pyrrol-2-yl]-[4-(2-trimethylsilylethynyl)phenyl]methanol.
| Compound Name | [5-[[5-[hydroxy-(4-iodophenyl)methyl]-1H-pyrrol-2-yl]-(2,3,4,5,6-pentafluorophenyl)methyl]-1H-pyrrol-2-yl]-[4-(2-trimethylsilylethynyl)phenyl]methanol |
|---|---|
| PubChem CID | 10628847 |
| Molecular Formula | C34H28F5IN2O2Si |
| Molecular Weight | 746.59 g/mol |
| Exact Mass | 746.09 |
| IUPAC Name | [5-[[5-[hydroxy-(4-iodophenyl)methyl]-1H-pyrrol-2-yl]-(2,3,4,5,6-pentafluorophenyl)methyl]-1H-pyrrol-2-yl]-[4-(2-trimethylsilylethynyl)phenyl]methanol |
| SMILES | C[Si](C)(C)C#Cc1ccc(C(O)c2ccc(C(c3ccc(C(O)c4ccc(I)cc4)[nH]3)c3c(F)c(F)c(F)c(F)c3F)[nH]2)cc1 |
| InChI | InChI=1S/C34H28F5IN2O2Si/c1-45(2,3)17-16-18-4-6-19(7-5-18)33(43)24-14-12-22(41-24)26(27-28(35)30(37)32(39)31(38)29(27)36)23-13-15-25(42-23)34(44)20-8-10-21(40)11-9-20/h4-15,26,33-34,41-44H,1-3H3 |
| InChIKey | SUNXOOBWSVLXFB-UHFFFAOYSA-N |
| XLogP | 8.22 |
| TPSA | 72.04 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 746.59 |
| LogP ≤ 5 | 8.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|