C15H21BrFNO2 — CID 106288554
N-(2-bromo-3-ethylpentyl)-3-fluoro-4-methoxybenzamide (PubChem CID 106288554) has the molecular formula C15H21BrFNO2 and a molecular weight of 346.24 g/mol. Its IUPAC name is N-(2-bromo-3-ethylpentyl)-3-fluoro-4-methoxybenzamide.
| Compound Name | N-(2-bromo-3-ethylpentyl)-3-fluoro-4-methoxybenzamide |
|---|---|
| PubChem CID | 106288554 |
| Molecular Formula | C15H21BrFNO2 |
| Molecular Weight | 346.24 g/mol |
| Exact Mass | 345.07 |
| IUPAC Name | N-(2-bromo-3-ethylpentyl)-3-fluoro-4-methoxybenzamide |
| SMILES | CCC(CC)C(Br)CNC(=O)c1ccc(OC)c(F)c1 |
| InChI | InChI=1S/C15H21BrFNO2/c1-4-10(5-2)12(16)9-18-15(19)11-6-7-14(20-3)13(17)8-11/h6-8,10,12H,4-5,9H2,1-3H3,(H,18,19) |
| InChIKey | OLHNPWOJSZCSOZ-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.24 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|