C11H21NO — CID 106288750
1-(2,5-dihydropyrrol-1-yl)-3-ethylpentan-2-ol (PubChem CID 106288750) has the molecular formula C11H21NO and a molecular weight of 183.30 g/mol. Its IUPAC name is 1-(2,5-dihydropyrrol-1-yl)-3-ethylpentan-2-ol.
| Compound Name | 1-(2,5-dihydropyrrol-1-yl)-3-ethylpentan-2-ol |
|---|---|
| PubChem CID | 106288750 |
| Molecular Formula | C11H21NO |
| Molecular Weight | 183.30 g/mol |
| Exact Mass | 183.16 |
| IUPAC Name | 1-(2,5-dihydropyrrol-1-yl)-3-ethylpentan-2-ol |
| SMILES | CCC(CC)C(O)CN1CC=CC1 |
| InChI | InChI=1S/C11H21NO/c1-3-10(4-2)11(13)9-12-7-5-6-8-12/h5-6,10-11,13H,3-4,7-9H2,1-2H3 |
| InChIKey | MWJTZNOQEMIKJG-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.30 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|