C42H82O7Si2 — CID 10628908
(E,11R)-11-(2-trimethylsilylethoxymethoxy)-11-[(2R,5R)-5-[(2R,5R)-5-[(E,1R)-1-(2-trimethylsilylethoxymethoxy)undec-2-enyl]oxolan-2-yl]oxolan-2-yl]undec-9-en-1-ol (PubChem CID 10628908) has the molecular formula C42H82O7Si2 and a molecular weight of 755.28 g/mol. Its IUPAC name is (E,11R)-11-(2-trimethylsilylethoxymethoxy)-11-[(2R,5R)-5-[(2R,5R)-5-[(E,1R)-1-(2-trimethylsilylethoxymethoxy)undec-2-enyl]oxolan-2-yl]oxolan-2-yl]undec-9-en-1-ol.
| Compound Name | (E,11R)-11-(2-trimethylsilylethoxymethoxy)-11-[(2R,5R)-5-[(2R,5R)-5-[(E,1R)-1-(2-trimethylsilylethoxymethoxy)undec-2-enyl]oxolan-2-yl]oxolan-2-yl]undec-9-en-1-ol |
|---|---|
| PubChem CID | 10628908 |
| Molecular Formula | C42H82O7Si2 |
| Molecular Weight | 755.28 g/mol |
| Exact Mass | 754.56 |
| IUPAC Name | (E,11R)-11-(2-trimethylsilylethoxymethoxy)-11-[(2R,5R)-5-[(2R,5R)-5-[(E,1R)-1-(2-trimethylsilylethoxymethoxy)undec-2-enyl]oxolan-2-yl]oxolan-2-yl]undec-9-en-1-ol |
| SMILES | CCCCCCCC/C=C/[C@@H](OCOCC[Si](C)(C)C)[C@H]1CC[C@H]([C@H]2CC[C@H]([C@@H](/C=C/CCCCCCCCO)OCOCC[Si](C)(C)C)O2)O1 |
| InChI | InChI=1S/C42H82O7Si2/c1-8-9-10-11-12-15-18-21-24-37(46-35-44-31-33-50(2,3)4)39-26-28-41(48-39)42-29-27-40(49-42)38(47-36-45-32-34-51(5,6)7)25-22-19-16-13-14-17-20-23-30-43/h21-22,24-25,37-43H,8-20,23,26-36H2,1-7H3/b24-21+,25-22+/t37-,38-,39-,40-,41-,42-/m1/s1 |
| InChIKey | SQURSZSTICKJJI-RLTBCBHNSA-N |
| XLogP | 11.06 |
| TPSA | 75.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 32 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 755.28 |
| LogP ≤ 5 | 11.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|