C9H14F4N4O — CID 106289293
3-[4-[(2,2,3,3-tetrafluoropropylamino)methyl]triazol-1-yl]propan-1-ol (PubChem CID 106289293) has the molecular formula C9H14F4N4O and a molecular weight of 270.23 g/mol. Its IUPAC name is 3-[4-[(2,2,3,3-tetrafluoropropylamino)methyl]triazol-1-yl]propan-1-ol.
| Compound Name | 3-[4-[(2,2,3,3-tetrafluoropropylamino)methyl]triazol-1-yl]propan-1-ol |
|---|---|
| PubChem CID | 106289293 |
| Molecular Formula | C9H14F4N4O |
| Molecular Weight | 270.23 g/mol |
| Exact Mass | 270.11 |
| IUPAC Name | 3-[4-[(2,2,3,3-tetrafluoropropylamino)methyl]triazol-1-yl]propan-1-ol |
| SMILES | OCCCn1cc(CNCC(F)(F)C(F)F)nn1 |
| InChI | InChI=1S/C9H14F4N4O/c10-8(11)9(12,13)6-14-4-7-5-17(16-15-7)2-1-3-18/h5,8,14,18H,1-4,6H2 |
| InChIKey | VWYAPHMPESOLDC-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 62.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.23 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|