C10H11BrF4N2O2S — CID 106289480
3-amino-5-bromo-2-methyl-N-(2,2,3,3-tetrafluoropropyl)benzenesulfonamide (PubChem CID 106289480) has the molecular formula C10H11BrF4N2O2S and a molecular weight of 379.17 g/mol. Its IUPAC name is 3-amino-5-bromo-2-methyl-N-(2,2,3,3-tetrafluoropropyl)benzenesulfonamide.
| Compound Name | 3-amino-5-bromo-2-methyl-N-(2,2,3,3-tetrafluoropropyl)benzenesulfonamide |
|---|---|
| PubChem CID | 106289480 |
| Molecular Formula | C10H11BrF4N2O2S |
| Molecular Weight | 379.17 g/mol |
| Exact Mass | 377.97 |
| IUPAC Name | 3-amino-5-bromo-2-methyl-N-(2,2,3,3-tetrafluoropropyl)benzenesulfonamide |
| SMILES | Cc1c(N)cc(Br)cc1S(=O)(=O)NCC(F)(F)C(F)F |
| InChI | InChI=1S/C10H11BrF4N2O2S/c1-5-7(16)2-6(11)3-8(5)20(18,19)17-4-10(14,15)9(12)13/h2-3,9,17H,4,16H2,1H3 |
| InChIKey | DZISZORYTGKIJV-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.17 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|