C11H14F4N2O2S — CID 106289483
2-amino-3,6-dimethyl-N-(2,2,3,3-tetrafluoropropyl)benzenesulfonamide (PubChem CID 106289483) has the molecular formula C11H14F4N2O2S and a molecular weight of 314.30 g/mol. Its IUPAC name is 2-amino-3,6-dimethyl-N-(2,2,3,3-tetrafluoropropyl)benzenesulfonamide.
| Compound Name | 2-amino-3,6-dimethyl-N-(2,2,3,3-tetrafluoropropyl)benzenesulfonamide |
|---|---|
| PubChem CID | 106289483 |
| Molecular Formula | C11H14F4N2O2S |
| Molecular Weight | 314.30 g/mol |
| Exact Mass | 314.07 |
| IUPAC Name | 2-amino-3,6-dimethyl-N-(2,2,3,3-tetrafluoropropyl)benzenesulfonamide |
| SMILES | Cc1ccc(C)c(S(=O)(=O)NCC(F)(F)C(F)F)c1N |
| InChI | InChI=1S/C11H14F4N2O2S/c1-6-3-4-7(2)9(8(6)16)20(18,19)17-5-11(14,15)10(12)13/h3-4,10,17H,5,16H2,1-2H3 |
| InChIKey | JIMYRAGIKAQPHF-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.30 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|