C12H19ClN2O3S — CID 106289599
4-amino-2-chloro-N-(2-hydroxy-2-methylpentyl)benzenesulfonamide (PubChem CID 106289599) has the molecular formula C12H19ClN2O3S and a molecular weight of 306.81 g/mol. Its IUPAC name is 4-amino-2-chloro-N-(2-hydroxy-2-methylpentyl)benzenesulfonamide.
| Compound Name | 4-amino-2-chloro-N-(2-hydroxy-2-methylpentyl)benzenesulfonamide |
|---|---|
| PubChem CID | 106289599 |
| Molecular Formula | C12H19ClN2O3S |
| Molecular Weight | 306.81 g/mol |
| Exact Mass | 306.08 |
| IUPAC Name | 4-amino-2-chloro-N-(2-hydroxy-2-methylpentyl)benzenesulfonamide |
| SMILES | CCCC(C)(O)CNS(=O)(=O)c1ccc(N)cc1Cl |
| InChI | InChI=1S/C12H19ClN2O3S/c1-3-6-12(2,16)8-15-19(17,18)11-5-4-9(14)7-10(11)13/h4-5,7,15-16H,3,6,8,14H2,1-2H3 |
| InChIKey | HYCJHPGZWCQHPP-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.81 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|