C10H16F4N4 — CID 106289812
1-methyl-3-propan-2-yl-5-N-(2,2,3,3-tetrafluoropropyl)pyrazole-4,5-diamine (PubChem CID 106289812) has the molecular formula C10H16F4N4 and a molecular weight of 268.26 g/mol. Its IUPAC name is 1-methyl-3-propan-2-yl-5-N-(2,2,3,3-tetrafluoropropyl)pyrazole-4,5-diamine.
| Compound Name | 1-methyl-3-propan-2-yl-5-N-(2,2,3,3-tetrafluoropropyl)pyrazole-4,5-diamine |
|---|---|
| PubChem CID | 106289812 |
| Molecular Formula | C10H16F4N4 |
| Molecular Weight | 268.26 g/mol |
| Exact Mass | 268.13 |
| IUPAC Name | 1-methyl-3-propan-2-yl-5-N-(2,2,3,3-tetrafluoropropyl)pyrazole-4,5-diamine |
| SMILES | CC(C)c1nn(C)c(NCC(F)(F)C(F)F)c1N |
| InChI | InChI=1S/C10H16F4N4/c1-5(2)7-6(15)8(18(3)17-7)16-4-10(13,14)9(11)12/h5,9,16H,4,15H2,1-3H3 |
| InChIKey | JBPBSYLAUCULAK-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 55.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.26 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|