C10H9F4N3O2 — CID 106289856
6-amino-5-(2,2,3,3-tetrafluoropropylamino)-3H-1,3-benzoxazol-2-one (PubChem CID 106289856) has the molecular formula C10H9F4N3O2 and a molecular weight of 279.19 g/mol. Its IUPAC name is 6-amino-5-(2,2,3,3-tetrafluoropropylamino)-3H-1,3-benzoxazol-2-one.
| Compound Name | 6-amino-5-(2,2,3,3-tetrafluoropropylamino)-3H-1,3-benzoxazol-2-one |
|---|---|
| PubChem CID | 106289856 |
| Molecular Formula | C10H9F4N3O2 |
| Molecular Weight | 279.19 g/mol |
| Exact Mass | 279.06 |
| IUPAC Name | 6-amino-5-(2,2,3,3-tetrafluoropropylamino)-3H-1,3-benzoxazol-2-one |
| SMILES | Nc1cc2oc(=O)[nH]c2cc1NCC(F)(F)C(F)F |
| InChI | InChI=1S/C10H9F4N3O2/c11-8(12)10(13,14)3-16-5-2-6-7(1-4(5)15)19-9(18)17-6/h1-2,8,16H,3,15H2,(H,17,18) |
| InChIKey | GACCSATXFMXGMI-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 84.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.19 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|