C10H13F4N3 — CID 106289960
2,2,3,3-tetrafluoro-N-[1-(3-methylpyrazin-2-yl)ethyl]propan-1-amine (PubChem CID 106289960) has the molecular formula C10H13F4N3 and a molecular weight of 251.23 g/mol. Its IUPAC name is 2,2,3,3-tetrafluoro-N-[1-(3-methylpyrazin-2-yl)ethyl]propan-1-amine.
| Compound Name | 2,2,3,3-tetrafluoro-N-[1-(3-methylpyrazin-2-yl)ethyl]propan-1-amine |
|---|---|
| PubChem CID | 106289960 |
| Molecular Formula | C10H13F4N3 |
| Molecular Weight | 251.23 g/mol |
| Exact Mass | 251.10 |
| IUPAC Name | 2,2,3,3-tetrafluoro-N-[1-(3-methylpyrazin-2-yl)ethyl]propan-1-amine |
| SMILES | Cc1nccnc1C(C)NCC(F)(F)C(F)F |
| InChI | InChI=1S/C10H13F4N3/c1-6-8(16-4-3-15-6)7(2)17-5-10(13,14)9(11)12/h3-4,7,9,17H,5H2,1-2H3 |
| InChIKey | DHJPENFYMNAAQD-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.23 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|