C6H6F4N2S — CID 106290318
3-(2,2,3,3-tetrafluoropropyl)-1H-imidazole-2-thione (PubChem CID 106290318) has the molecular formula C6H6F4N2S and a molecular weight of 214.19 g/mol. Its IUPAC name is 3-(2,2,3,3-tetrafluoropropyl)-1H-imidazole-2-thione.
| Compound Name | 3-(2,2,3,3-tetrafluoropropyl)-1H-imidazole-2-thione |
|---|---|
| PubChem CID | 106290318 |
| Molecular Formula | C6H6F4N2S |
| Molecular Weight | 214.19 g/mol |
| Exact Mass | 214.02 |
| IUPAC Name | 3-(2,2,3,3-tetrafluoropropyl)-1H-imidazole-2-thione |
| SMILES | FC(F)C(F)(F)Cn1cc[nH]c1=S |
| InChI | InChI=1S/C6H6F4N2S/c7-4(8)6(9,10)3-12-2-1-11-5(12)13/h1-2,4H,3H2,(H,11,13) |
| InChIKey | PPLCXTPXMQQSSJ-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 20.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.19 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|