C46H55N2O7P — CID 10629038
11-diethoxyphosphoryl-7,18-di(nonan-5-yl)-7,18-diazaheptacyclo[14.6.2.22,5.03,12.04,9.013,23.020,24]hexacosa-1(23),2,4,9,11,13,15,20(24),21,25-decaene-6,8,17,19-tetrone (PubChem CID 10629038) has the molecular formula C46H55N2O7P and a molecular weight of 778.93 g/mol. Its IUPAC name is 11-diethoxyphosphoryl-7,18-di(nonan-5-yl)-7,18-diazaheptacyclo[14.6.2.22,5.03,12.04,9.013,23.020,24]hexacosa-1(23),2,4,9,11,13,15,20(24),21,25-decaene-6,8,17,19-tetrone.
| Compound Name | 11-diethoxyphosphoryl-7,18-di(nonan-5-yl)-7,18-diazaheptacyclo[14.6.2.22,5.03,12.04,9.013,23.020,24]hexacosa-1(23),2,4,9,11,13,15,20(24),21,25-decaene-6,8,17,19-tetrone |
|---|---|
| PubChem CID | 10629038 |
| Molecular Formula | C46H55N2O7P |
| Molecular Weight | 778.93 g/mol |
| Exact Mass | 778.37 |
| IUPAC Name | 11-diethoxyphosphoryl-7,18-di(nonan-5-yl)-7,18-diazaheptacyclo[14.6.2.22,5.03,12.04,9.013,23.020,24]hexacosa-1(23),2,4,9,11,13,15,20(24),21,25-decaene-6,8,17,19-tetrone |
| SMILES | CCCCC(CCCC)N1C(=O)c2ccc3c4ccc5c6c(cc(P(=O)(OCC)OCC)c(c7ccc(c2c37)C1=O)c64)C(=O)N(C(CCCC)CCCC)C5=O |
| InChI | InChI=1S/C46H55N2O7P/c1-7-13-17-28(18-14-8-2)47-43(49)33-24-21-30-31-22-25-35-40-36(46(52)48(45(35)51)29(19-15-9-3)20-16-10-4)27-37(56(53,54-11-5)55-12-6)41(42(31)40)32-23-26-34(44(47)50)39(33)38(30)32/h21-29H,7-20H2,1-6H3 |
| InChIKey | NXBFHZJKHIHGHF-UHFFFAOYSA-N |
| XLogP | 11.32 |
| TPSA | 110.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 778.93 |
| LogP ≤ 5 | 11.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|