C11H15F4NO3 — CID 106290398
1-[2-oxo-2-(2,2,3,3-tetrafluoropropylamino)ethyl]cyclopentane-1-carboxylic acid (PubChem CID 106290398) has the molecular formula C11H15F4NO3 and a molecular weight of 285.24 g/mol. Its IUPAC name is 1-[2-oxo-2-(2,2,3,3-tetrafluoropropylamino)ethyl]cyclopentane-1-carboxylic acid.
| Compound Name | 1-[2-oxo-2-(2,2,3,3-tetrafluoropropylamino)ethyl]cyclopentane-1-carboxylic acid |
|---|---|
| PubChem CID | 106290398 |
| Molecular Formula | C11H15F4NO3 |
| Molecular Weight | 285.24 g/mol |
| Exact Mass | 285.10 |
| IUPAC Name | 1-[2-oxo-2-(2,2,3,3-tetrafluoropropylamino)ethyl]cyclopentane-1-carboxylic acid |
| SMILES | O=C(CC1(C(=O)O)CCCC1)NCC(F)(F)C(F)F |
| InChI | InChI=1S/C11H15F4NO3/c12-8(13)11(14,15)6-16-7(17)5-10(9(18)19)3-1-2-4-10/h8H,1-6H2,(H,16,17)(H,18,19) |
| InChIKey | ZKIIFTGTVJUOHP-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.24 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|