C10H12F4N4S — CID 106290402
3-ethyl-1-methyl-6-(2,2,3,3-tetrafluoropropyl)-4H-imidazo[4,5-d]pyrazole-5-thione (PubChem CID 106290402) has the molecular formula C10H12F4N4S and a molecular weight of 296.29 g/mol. Its IUPAC name is 3-ethyl-1-methyl-6-(2,2,3,3-tetrafluoropropyl)-4H-imidazo[4,5-d]pyrazole-5-thione.
| Compound Name | 3-ethyl-1-methyl-6-(2,2,3,3-tetrafluoropropyl)-4H-imidazo[4,5-d]pyrazole-5-thione |
|---|---|
| PubChem CID | 106290402 |
| Molecular Formula | C10H12F4N4S |
| Molecular Weight | 296.29 g/mol |
| Exact Mass | 296.07 |
| IUPAC Name | 3-ethyl-1-methyl-6-(2,2,3,3-tetrafluoropropyl)-4H-imidazo[4,5-d]pyrazole-5-thione |
| SMILES | CCc1nn(C)c2c1[nH]c(=S)n2CC(F)(F)C(F)F |
| InChI | InChI=1S/C10H12F4N4S/c1-3-5-6-7(17(2)16-5)18(9(19)15-6)4-10(13,14)8(11)12/h8H,3-4H2,1-2H3,(H,15,19) |
| InChIKey | RNYXEFHNJRMGQP-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 38.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.29 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|