C7H8F4N2S — CID 106290529
5-methyl-3-(2,2,3,3-tetrafluoropropyl)-1H-imidazole-2-thione (PubChem CID 106290529) has the molecular formula C7H8F4N2S and a molecular weight of 228.21 g/mol. Its IUPAC name is 5-methyl-3-(2,2,3,3-tetrafluoropropyl)-1H-imidazole-2-thione.
| Compound Name | 5-methyl-3-(2,2,3,3-tetrafluoropropyl)-1H-imidazole-2-thione |
|---|---|
| PubChem CID | 106290529 |
| Molecular Formula | C7H8F4N2S |
| Molecular Weight | 228.21 g/mol |
| Exact Mass | 228.03 |
| IUPAC Name | 5-methyl-3-(2,2,3,3-tetrafluoropropyl)-1H-imidazole-2-thione |
| SMILES | Cc1cn(CC(F)(F)C(F)F)c(=S)[nH]1 |
| InChI | InChI=1S/C7H8F4N2S/c1-4-2-13(6(14)12-4)3-7(10,11)5(8)9/h2,5H,3H2,1H3,(H,12,14) |
| InChIKey | XHMSKRIVLSGTTG-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 20.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.21 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|