C9H11F4N3O4S — CID 106290590
3-[4-(2,2,3,3-tetrafluoropropylsulfamoyl)pyrazol-1-yl]propanoic acid (PubChem CID 106290590) has the molecular formula C9H11F4N3O4S and a molecular weight of 333.26 g/mol. Its IUPAC name is 3-[4-(2,2,3,3-tetrafluoropropylsulfamoyl)pyrazol-1-yl]propanoic acid.
| Compound Name | 3-[4-(2,2,3,3-tetrafluoropropylsulfamoyl)pyrazol-1-yl]propanoic acid |
|---|---|
| PubChem CID | 106290590 |
| Molecular Formula | C9H11F4N3O4S |
| Molecular Weight | 333.26 g/mol |
| Exact Mass | 333.04 |
| IUPAC Name | 3-[4-(2,2,3,3-tetrafluoropropylsulfamoyl)pyrazol-1-yl]propanoic acid |
| SMILES | O=C(O)CCn1cc(S(=O)(=O)NCC(F)(F)C(F)F)cn1 |
| InChI | InChI=1S/C9H11F4N3O4S/c10-8(11)9(12,13)5-15-21(19,20)6-3-14-16(4-6)2-1-7(17)18/h3-4,8,15H,1-2,5H2,(H,17,18) |
| InChIKey | ZBIBUBGSXDQRCE-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.26 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|