C9H9F4NO5S — CID 106290601
5-methyl-4-(2,2,3,3-tetrafluoropropylsulfamoyl)furan-2-carboxylic acid (PubChem CID 106290601) has the molecular formula C9H9F4NO5S and a molecular weight of 319.23 g/mol. Its IUPAC name is 5-methyl-4-(2,2,3,3-tetrafluoropropylsulfamoyl)furan-2-carboxylic acid.
| Compound Name | 5-methyl-4-(2,2,3,3-tetrafluoropropylsulfamoyl)furan-2-carboxylic acid |
|---|---|
| PubChem CID | 106290601 |
| Molecular Formula | C9H9F4NO5S |
| Molecular Weight | 319.23 g/mol |
| Exact Mass | 319.01 |
| IUPAC Name | 5-methyl-4-(2,2,3,3-tetrafluoropropylsulfamoyl)furan-2-carboxylic acid |
| SMILES | Cc1oc(C(=O)O)cc1S(=O)(=O)NCC(F)(F)C(F)F |
| InChI | InChI=1S/C9H9F4NO5S/c1-4-6(2-5(19-4)7(15)16)20(17,18)14-3-9(12,13)8(10)11/h2,8,14H,3H2,1H3,(H,15,16) |
| InChIKey | ZUMQDUYVOGVJPI-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 96.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.23 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|