About 2-(2-hydroxy-2-methylpentyl)-4,4-dimethyl-1,1-dioxothiazetidin-3-one
2-(2-hydroxy-2-methylpentyl)-4,4-dimethyl-1,1-dioxothiazetidin-3-one (PubChem CID 106291195) has the molecular formula C10H19NO4S
and a molecular weight of 249.33 g/mol. Its IUPAC name is 2-(2-hydroxy-2-methylpentyl)-4,4-dimethyl-1,1-dioxothiazetidin-3-one.
Molecular Properties
| Compound Name | 2-(2-hydroxy-2-methylpentyl)-4,4-dimethyl-1,1-dioxothiazetidin-3-one |
| PubChem CID | 106291195 |
| Molecular Formula | C10H19NO4S |
| Molecular Weight | 249.33 g/mol |
| Exact Mass | 249.10 |
| IUPAC Name | 2-(2-hydroxy-2-methylpentyl)-4,4-dimethyl-1,1-dioxothiazetidin-3-one |
| SMILES | CCCC(C)(O)CN1C(=O)C(C)(C)S1(=O)=O |
| InChI | InChI=1S/C10H19NO4S/c1-5-6-10(4,13)7-11-8(12)9(2,3)16(11,14)15/h13H,5-7H2,1-4H3 |
| InChIKey | GKRZAEMLGOSFPY-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.33 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(2-hydroxy-2-methylpentyl)-4,4-dimethyl-1,1-dioxothiazetidin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-hydroxy-2-methylpentyl)-4,4-dimethyl-1,1-dioxothiazetidin-3-one?
The IUPAC name of 2-(2-hydroxy-2-methylpentyl)-4,4-dimethyl-1,1-dioxothiazetidin-3-one (CID 106291195) is 2-(2-hydroxy-2-methylpentyl)-4,4-dimethyl-1,1-dioxothiazetidin-3-one.
What is the SMILES notation for 2-(2-hydroxy-2-methylpentyl)-4,4-dimethyl-1,1-dioxothiazetidin-3-one?
The canonical SMILES for 2-(2-hydroxy-2-methylpentyl)-4,4-dimethyl-1,1-dioxothiazetidin-3-one is CCCC(C)(O)CN1C(=O)C(C)(C)S1(=O)=O.
What is the InChIKey of 2-(2-hydroxy-2-methylpentyl)-4,4-dimethyl-1,1-dioxothiazetidin-3-one?
The InChIKey is GKRZAEMLGOSFPY-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H19NO4S/c1-5-6-10(4,13)7-11-8(12)9(2,3)16(11,14)15/h13H,5-7H2,1-4H3.
What are the key properties of 2-(2-hydroxy-2-methylpentyl)-4,4-dimethyl-1,1-dioxothiazetidin-3-one?
2-(2-hydroxy-2-methylpentyl)-4,4-dimethyl-1,1-dioxothiazetidin-3-one has a molecular weight of 249.33 g/mol, XLogP of 0.49, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-hydroxy-2-methylpentyl)-4,4-dimethyl-1,1-dioxothiazetidin-3-one is sourced from PubChem (CID 106291195), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).