C6H6ClF4N3 — CID 106291264
3-chloro-5-methyl-4-(2,2,3,3-tetrafluoropropyl)-1,2,4-triazole (PubChem CID 106291264) has the molecular formula C6H6ClF4N3 and a molecular weight of 231.58 g/mol. Its IUPAC name is 3-chloro-5-methyl-4-(2,2,3,3-tetrafluoropropyl)-1,2,4-triazole.
| Compound Name | 3-chloro-5-methyl-4-(2,2,3,3-tetrafluoropropyl)-1,2,4-triazole |
|---|---|
| PubChem CID | 106291264 |
| Molecular Formula | C6H6ClF4N3 |
| Molecular Weight | 231.58 g/mol |
| Exact Mass | 231.02 |
| IUPAC Name | 3-chloro-5-methyl-4-(2,2,3,3-tetrafluoropropyl)-1,2,4-triazole |
| SMILES | Cc1nnc(Cl)n1CC(F)(F)C(F)F |
| InChI | InChI=1S/C6H6ClF4N3/c1-3-12-13-5(7)14(3)2-6(10,11)4(8)9/h4H,2H2,1H3 |
| InChIKey | PCVFMVMZVKPDNB-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.58 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|