C12H20F4N2O — CID 106291418
1-(aminomethyl)-4-methyl-N-(2,2,3,3-tetrafluoropropyl)cyclohexane-1-carboxamide (PubChem CID 106291418) has the molecular formula C12H20F4N2O and a molecular weight of 284.30 g/mol. Its IUPAC name is 1-(aminomethyl)-4-methyl-N-(2,2,3,3-tetrafluoropropyl)cyclohexane-1-carboxamide.
| Compound Name | 1-(aminomethyl)-4-methyl-N-(2,2,3,3-tetrafluoropropyl)cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 106291418 |
| Molecular Formula | C12H20F4N2O |
| Molecular Weight | 284.30 g/mol |
| Exact Mass | 284.15 |
| IUPAC Name | 1-(aminomethyl)-4-methyl-N-(2,2,3,3-tetrafluoropropyl)cyclohexane-1-carboxamide |
| SMILES | CC1CCC(CN)(C(=O)NCC(F)(F)C(F)F)CC1 |
| InChI | InChI=1S/C12H20F4N2O/c1-8-2-4-11(6-17,5-3-8)10(19)18-7-12(15,16)9(13)14/h8-9H,2-7,17H2,1H3,(H,18,19) |
| InChIKey | ZCKHSLDUFDRNFS-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.30 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|