C47H34N4O5Zn — CID 10629153
zinc 2-(10,20-diphenylporphyrin-22,24-diid-5-yl)-5,8-dimethoxy-3-propan-2-yloxynaphthalene-1,4-dione (PubChem CID 10629153) has the molecular formula C47H34N4O5Zn and a molecular weight of 800.20 g/mol. Its IUPAC name is zinc 2-(10,20-diphenylporphyrin-22,24-diid-5-yl)-5,8-dimethoxy-3-propan-2-yloxynaphthalene-1,4-dione.
| Compound Name | zinc 2-(10,20-diphenylporphyrin-22,24-diid-5-yl)-5,8-dimethoxy-3-propan-2-yloxynaphthalene-1,4-dione |
|---|---|
| PubChem CID | 10629153 |
| Molecular Formula | C47H34N4O5Zn |
| Molecular Weight | 800.20 g/mol |
| Exact Mass | 798.18 |
| IUPAC Name | zinc 2-(10,20-diphenylporphyrin-22,24-diid-5-yl)-5,8-dimethoxy-3-propan-2-yloxynaphthalene-1,4-dione |
| SMILES | COc1ccc(OC)c2c1C(=O)C(OC(C)C)=C(c1c3nc(c(-c4ccccc4)c4ccc(cc5nc(c(-c6ccccc6)c6ccc1[n-]6)C=C5)[n-]4)C=C3)C2=O.[Zn+2] |
| InChI | InChI=1S/C47H36N4O5.Zn/c1-26(2)56-47-44(45(52)42-37(54-3)23-24-38(55-4)43(42)46(47)53)41-35-21-19-33(50-35)39(27-11-7-5-8-12-27)31-17-15-29(48-31)25-30-16-18-32(49-30)40(28-13-9-6-10-14-28)34-20-22-36(41)51-34;/h5-26H,1-4H3,(H2,48,49,50,51,52,53);/q;+2/p-2/b29-25-,30-25-,39-31-,39-33-,40-32-,40-34-,41-35+,41-36+; |
| InChIKey | CEGWDPVLXHYNTP-STXCFQDLSA-L |
| XLogP | 9.48 |
| TPSA | 115.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 800.20 |
| LogP ≤ 5 | 9.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|