C8H12F4N2O — CID 106291699
2-amino-N-(2,2,3,3-tetrafluoropropyl)pent-4-enamide (PubChem CID 106291699) has the molecular formula C8H12F4N2O and a molecular weight of 228.19 g/mol. Its IUPAC name is 2-amino-N-(2,2,3,3-tetrafluoropropyl)pent-4-enamide.
| Compound Name | 2-amino-N-(2,2,3,3-tetrafluoropropyl)pent-4-enamide |
|---|---|
| PubChem CID | 106291699 |
| Molecular Formula | C8H12F4N2O |
| Molecular Weight | 228.19 g/mol |
| Exact Mass | 228.09 |
| IUPAC Name | 2-amino-N-(2,2,3,3-tetrafluoropropyl)pent-4-enamide |
| SMILES | C=CCC(N)C(=O)NCC(F)(F)C(F)F |
| InChI | InChI=1S/C8H12F4N2O/c1-2-3-5(13)6(15)14-4-8(11,12)7(9)10/h2,5,7H,1,3-4,13H2,(H,14,15) |
| InChIKey | ZJBKXDGSPRLONS-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.19 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|