C10H16F4N2O — CID 106291709
2-[1-(aminomethyl)cyclobutyl]-N-(2,2,3,3-tetrafluoropropyl)acetamide (PubChem CID 106291709) has the molecular formula C10H16F4N2O and a molecular weight of 256.24 g/mol. Its IUPAC name is 2-[1-(aminomethyl)cyclobutyl]-N-(2,2,3,3-tetrafluoropropyl)acetamide.
| Compound Name | 2-[1-(aminomethyl)cyclobutyl]-N-(2,2,3,3-tetrafluoropropyl)acetamide |
|---|---|
| PubChem CID | 106291709 |
| Molecular Formula | C10H16F4N2O |
| Molecular Weight | 256.24 g/mol |
| Exact Mass | 256.12 |
| IUPAC Name | 2-[1-(aminomethyl)cyclobutyl]-N-(2,2,3,3-tetrafluoropropyl)acetamide |
| SMILES | NCC1(CC(=O)NCC(F)(F)C(F)F)CCC1 |
| InChI | InChI=1S/C10H16F4N2O/c11-8(12)10(13,14)6-16-7(17)4-9(5-15)2-1-3-9/h8H,1-6,15H2,(H,16,17) |
| InChIKey | MCYNVPHAEAZIJD-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.24 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|