C10H17F4NO2S — CID 106291768
3-methylsulfonyl-N-(2,2,3,3-tetrafluoropropyl)cyclohexan-1-amine (PubChem CID 106291768) has the molecular formula C10H17F4NO2S and a molecular weight of 291.31 g/mol. Its IUPAC name is 3-methylsulfonyl-N-(2,2,3,3-tetrafluoropropyl)cyclohexan-1-amine.
| Compound Name | 3-methylsulfonyl-N-(2,2,3,3-tetrafluoropropyl)cyclohexan-1-amine |
|---|---|
| PubChem CID | 106291768 |
| Molecular Formula | C10H17F4NO2S |
| Molecular Weight | 291.31 g/mol |
| Exact Mass | 291.09 |
| IUPAC Name | 3-methylsulfonyl-N-(2,2,3,3-tetrafluoropropyl)cyclohexan-1-amine |
| SMILES | CS(=O)(=O)C1CCCC(NCC(F)(F)C(F)F)C1 |
| InChI | InChI=1S/C10H17F4NO2S/c1-18(16,17)8-4-2-3-7(5-8)15-6-10(13,14)9(11)12/h7-9,15H,2-6H2,1H3 |
| InChIKey | LXEXPJFPVOZXTM-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.31 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|