C12H20F4N2O2 — CID 106291837
1-amino-3-ethoxy-2,2-dimethyl-N-(2,2,3,3-tetrafluoropropyl)cyclobutane-1-carboxamide (PubChem CID 106291837) has the molecular formula C12H20F4N2O2 and a molecular weight of 300.30 g/mol. Its IUPAC name is 1-amino-3-ethoxy-2,2-dimethyl-N-(2,2,3,3-tetrafluoropropyl)cyclobutane-1-carboxamide.
| Compound Name | 1-amino-3-ethoxy-2,2-dimethyl-N-(2,2,3,3-tetrafluoropropyl)cyclobutane-1-carboxamide |
|---|---|
| PubChem CID | 106291837 |
| Molecular Formula | C12H20F4N2O2 |
| Molecular Weight | 300.30 g/mol |
| Exact Mass | 300.15 |
| IUPAC Name | 1-amino-3-ethoxy-2,2-dimethyl-N-(2,2,3,3-tetrafluoropropyl)cyclobutane-1-carboxamide |
| SMILES | CCOC1CC(N)(C(=O)NCC(F)(F)C(F)F)C1(C)C |
| InChI | InChI=1S/C12H20F4N2O2/c1-4-20-7-5-11(17,10(7,2)3)9(19)18-6-12(15,16)8(13)14/h7-8H,4-6,17H2,1-3H3,(H,18,19) |
| InChIKey | JUZCMAKYKUOJCP-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.30 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|