C11H12F5NO — CID 106291983
2,2,3,3-tetrafluoro-N-[(2-fluoro-3-methoxyphenyl)methyl]propan-1-amine (PubChem CID 106291983) has the molecular formula C11H12F5NO and a molecular weight of 269.21 g/mol. Its IUPAC name is 2,2,3,3-tetrafluoro-N-[(2-fluoro-3-methoxyphenyl)methyl]propan-1-amine.
| Compound Name | 2,2,3,3-tetrafluoro-N-[(2-fluoro-3-methoxyphenyl)methyl]propan-1-amine |
|---|---|
| PubChem CID | 106291983 |
| Molecular Formula | C11H12F5NO |
| Molecular Weight | 269.21 g/mol |
| Exact Mass | 269.08 |
| IUPAC Name | 2,2,3,3-tetrafluoro-N-[(2-fluoro-3-methoxyphenyl)methyl]propan-1-amine |
| SMILES | COc1cccc(CNCC(F)(F)C(F)F)c1F |
| InChI | InChI=1S/C11H12F5NO/c1-18-8-4-2-3-7(9(8)12)5-17-6-11(15,16)10(13)14/h2-4,10,17H,5-6H2,1H3 |
| InChIKey | DYJUMRPNODETOX-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.21 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|