C40H60O15Si — CID 10629209
hexamethyl (3E,8E,13E)-15-[2-[tert-butyl(dimethyl)silyl]oxy-2-ethenyl-1-methoxycarbonylcyclopropyl]pentadeca-3,8,13-triene-1,1,6,6,11,11-hexacarboxylate (PubChem CID 10629209) has the molecular formula C40H60O15Si and a molecular weight of 808.99 g/mol. Its IUPAC name is hexamethyl (3E,8E,13E)-15-[2-[tert-butyl(dimethyl)silyl]oxy-2-ethenyl-1-methoxycarbonylcyclopropyl]pentadeca-3,8,13-triene-1,1,6,6,11,11-hexacarboxylate.
| Compound Name | hexamethyl (3E,8E,13E)-15-[2-[tert-butyl(dimethyl)silyl]oxy-2-ethenyl-1-methoxycarbonylcyclopropyl]pentadeca-3,8,13-triene-1,1,6,6,11,11-hexacarboxylate |
|---|---|
| PubChem CID | 10629209 |
| Molecular Formula | C40H60O15Si |
| Molecular Weight | 808.99 g/mol |
| Exact Mass | 808.37 |
| IUPAC Name | hexamethyl (3E,8E,13E)-15-[2-[tert-butyl(dimethyl)silyl]oxy-2-ethenyl-1-methoxycarbonylcyclopropyl]pentadeca-3,8,13-triene-1,1,6,6,11,11-hexacarboxylate |
| SMILES | C=CC1(O[Si](C)(C)C(C)(C)C)CC1(C/C=C/CC(C/C=C/CC(C/C=C/CC(C(=O)OC)C(=O)OC)(C(=O)OC)C(=O)OC)(C(=O)OC)C(=O)OC)C(=O)OC |
| InChI | InChI=1S/C40H60O15Si/c1-14-40(55-56(12,13)36(2,3)4)27-39(40,35(47)54-11)26-20-19-25-38(33(45)52-9,34(46)53-10)24-18-17-23-37(31(43)50-7,32(44)51-8)22-16-15-21-28(29(41)48-5)30(42)49-6/h14-20,28H,1,21-27H2,2-13H3/b16-15+,18-17+,20-19+ |
| InChIKey | VTEVCGQNOAIBIY-LVJOJNLGSA-N |
| XLogP | 5.13 |
| TPSA | 193.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 56 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 808.99 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|