C12H17F4N3 — CID 106292284
N-[(1-cyclopentylpyrazol-3-yl)methyl]-2,2,3,3-tetrafluoropropan-1-amine (PubChem CID 106292284) has the molecular formula C12H17F4N3 and a molecular weight of 279.28 g/mol. Its IUPAC name is N-[(1-cyclopentylpyrazol-3-yl)methyl]-2,2,3,3-tetrafluoropropan-1-amine.
| Compound Name | N-[(1-cyclopentylpyrazol-3-yl)methyl]-2,2,3,3-tetrafluoropropan-1-amine |
|---|---|
| PubChem CID | 106292284 |
| Molecular Formula | C12H17F4N3 |
| Molecular Weight | 279.28 g/mol |
| Exact Mass | 279.14 |
| IUPAC Name | N-[(1-cyclopentylpyrazol-3-yl)methyl]-2,2,3,3-tetrafluoropropan-1-amine |
| SMILES | FC(F)C(F)(F)CNCc1ccn(C2CCCC2)n1 |
| InChI | InChI=1S/C12H17F4N3/c13-11(14)12(15,16)8-17-7-9-5-6-19(18-9)10-3-1-2-4-10/h5-6,10-11,17H,1-4,7-8H2 |
| InChIKey | VEQPBBIHHQMSTD-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.28 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|