C52H42N4O2Zn — CID 10629274
zinc 3,6-ditert-butyl-4-(10,15,20-triphenylporphyrin-22,24-diid-5-yl)cyclohexa-3,5-diene-1,2-dione (PubChem CID 10629274) has the molecular formula C52H42N4O2Zn and a molecular weight of 820.32 g/mol. Its IUPAC name is zinc 3,6-ditert-butyl-4-(10,15,20-triphenylporphyrin-22,24-diid-5-yl)cyclohexa-3,5-diene-1,2-dione.
| Compound Name | zinc 3,6-ditert-butyl-4-(10,15,20-triphenylporphyrin-22,24-diid-5-yl)cyclohexa-3,5-diene-1,2-dione |
|---|---|
| PubChem CID | 10629274 |
| Molecular Formula | C52H42N4O2Zn |
| Molecular Weight | 820.32 g/mol |
| Exact Mass | 818.26 |
| IUPAC Name | zinc 3,6-ditert-butyl-4-(10,15,20-triphenylporphyrin-22,24-diid-5-yl)cyclohexa-3,5-diene-1,2-dione |
| SMILES | CC(C)(C)C1=CC(c2c3nc(c(-c4ccccc4)c4ccc([n-]4)c(-c4ccccc4)c4nc(c(-c5ccccc5)c5ccc2[n-]5)C=C4)C=C3)=C(C(C)(C)C)C(=O)C1=O.[Zn+2] |
| InChI | InChI=1S/C52H44N4O2.Zn/c1-51(2,3)35-30-34(48(52(4,5)6)50(58)49(35)57)47-42-28-26-40(55-42)45(32-18-12-8-13-19-32)38-24-22-36(53-38)44(31-16-10-7-11-17-31)37-23-25-39(54-37)46(33-20-14-9-15-21-33)41-27-29-43(47)56-41;/h7-30H,1-6H3,(H2,53,54,55,56,57,58);/q;+2/p-2/b44-36-,44-37-,45-38-,45-40-,46-39-,46-41-,47-42-,47-43-; |
| InChIKey | FJQFOCOJXYMUJE-RUNSENEXSA-L |
| XLogP | 11.84 |
| TPSA | 88.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 820.32 |
| LogP ≤ 5 | 11.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'chinone_2', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|