C10H14F4N2OS — CID 106292820
1-carbamothioyl-3-methyl-N-(2,2,3,3-tetrafluoropropyl)cyclobutane-1-carboxamide (PubChem CID 106292820) has the molecular formula C10H14F4N2OS and a molecular weight of 286.29 g/mol. Its IUPAC name is 1-carbamothioyl-3-methyl-N-(2,2,3,3-tetrafluoropropyl)cyclobutane-1-carboxamide.
| Compound Name | 1-carbamothioyl-3-methyl-N-(2,2,3,3-tetrafluoropropyl)cyclobutane-1-carboxamide |
|---|---|
| PubChem CID | 106292820 |
| Molecular Formula | C10H14F4N2OS |
| Molecular Weight | 286.29 g/mol |
| Exact Mass | 286.08 |
| IUPAC Name | 1-carbamothioyl-3-methyl-N-(2,2,3,3-tetrafluoropropyl)cyclobutane-1-carboxamide |
| SMILES | CC1CC(C(=O)NCC(F)(F)C(F)F)(C(N)=S)C1 |
| InChI | InChI=1S/C10H14F4N2OS/c1-5-2-9(3-5,7(15)18)8(17)16-4-10(13,14)6(11)12/h5-6H,2-4H2,1H3,(H2,15,18)(H,16,17) |
| InChIKey | QKHRVFRWLFXRHP-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.29 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|