C12H20F4N2OS — CID 106292835
2-carbamothioyl-2-propyl-N-(2,2,3,3-tetrafluoropropyl)pentanamide (PubChem CID 106292835) has the molecular formula C12H20F4N2OS and a molecular weight of 316.36 g/mol. Its IUPAC name is 2-carbamothioyl-2-propyl-N-(2,2,3,3-tetrafluoropropyl)pentanamide.
| Compound Name | 2-carbamothioyl-2-propyl-N-(2,2,3,3-tetrafluoropropyl)pentanamide |
|---|---|
| PubChem CID | 106292835 |
| Molecular Formula | C12H20F4N2OS |
| Molecular Weight | 316.36 g/mol |
| Exact Mass | 316.12 |
| IUPAC Name | 2-carbamothioyl-2-propyl-N-(2,2,3,3-tetrafluoropropyl)pentanamide |
| SMILES | CCCC(CCC)(C(=O)NCC(F)(F)C(F)F)C(N)=S |
| InChI | InChI=1S/C12H20F4N2OS/c1-3-5-11(6-4-2,9(17)20)10(19)18-7-12(15,16)8(13)14/h8H,3-7H2,1-2H3,(H2,17,20)(H,18,19) |
| InChIKey | BBGDHCJIFGNSEZ-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.36 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|