C10H18F4N2O2S — CID 106293105
2-piperidin-2-yl-N-(2,2,3,3-tetrafluoropropyl)ethanesulfonamide (PubChem CID 106293105) has the molecular formula C10H18F4N2O2S and a molecular weight of 306.33 g/mol. Its IUPAC name is 2-piperidin-2-yl-N-(2,2,3,3-tetrafluoropropyl)ethanesulfonamide.
| Compound Name | 2-piperidin-2-yl-N-(2,2,3,3-tetrafluoropropyl)ethanesulfonamide |
|---|---|
| PubChem CID | 106293105 |
| Molecular Formula | C10H18F4N2O2S |
| Molecular Weight | 306.33 g/mol |
| Exact Mass | 306.10 |
| IUPAC Name | 2-piperidin-2-yl-N-(2,2,3,3-tetrafluoropropyl)ethanesulfonamide |
| SMILES | O=S(=O)(CCC1CCCCN1)NCC(F)(F)C(F)F |
| InChI | InChI=1S/C10H18F4N2O2S/c11-9(12)10(13,14)7-16-19(17,18)6-4-8-3-1-2-5-15-8/h8-9,15-16H,1-7H2 |
| InChIKey | RBYNTZIKMGQQPS-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.33 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|