C11H8F4N2O3 — CID 106293288
2-(2,2,3,3-tetrafluoropropylamino)-1,3-benzoxazole-6-carboxylic acid (PubChem CID 106293288) has the molecular formula C11H8F4N2O3 and a molecular weight of 292.19 g/mol. Its IUPAC name is 2-(2,2,3,3-tetrafluoropropylamino)-1,3-benzoxazole-6-carboxylic acid.
| Compound Name | 2-(2,2,3,3-tetrafluoropropylamino)-1,3-benzoxazole-6-carboxylic acid |
|---|---|
| PubChem CID | 106293288 |
| Molecular Formula | C11H8F4N2O3 |
| Molecular Weight | 292.19 g/mol |
| Exact Mass | 292.05 |
| IUPAC Name | 2-(2,2,3,3-tetrafluoropropylamino)-1,3-benzoxazole-6-carboxylic acid |
| SMILES | O=C(O)c1ccc2nc(NCC(F)(F)C(F)F)oc2c1 |
| InChI | InChI=1S/C11H8F4N2O3/c12-9(13)11(14,15)4-16-10-17-6-2-1-5(8(18)19)3-7(6)20-10/h1-3,9H,4H2,(H,16,17)(H,18,19) |
| InChIKey | GLKATEDRQHWAEJ-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 75.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.19 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|