C9H8ClF4N5 — CID 106293312
5-chloro-6-methyl-N-(2,2,3,3-tetrafluoropropyl)-[1,2,4]triazolo[1,5-a]pyrimidin-7-amine (PubChem CID 106293312) has the molecular formula C9H8ClF4N5 and a molecular weight of 297.64 g/mol. Its IUPAC name is 5-chloro-6-methyl-N-(2,2,3,3-tetrafluoropropyl)-[1,2,4]triazolo[1,5-a]pyrimidin-7-amine.
| Compound Name | 5-chloro-6-methyl-N-(2,2,3,3-tetrafluoropropyl)-[1,2,4]triazolo[1,5-a]pyrimidin-7-amine |
|---|---|
| PubChem CID | 106293312 |
| Molecular Formula | C9H8ClF4N5 |
| Molecular Weight | 297.64 g/mol |
| Exact Mass | 297.04 |
| IUPAC Name | 5-chloro-6-methyl-N-(2,2,3,3-tetrafluoropropyl)-[1,2,4]triazolo[1,5-a]pyrimidin-7-amine |
| SMILES | Cc1c(Cl)nc2ncnn2c1NCC(F)(F)C(F)F |
| InChI | InChI=1S/C9H8ClF4N5/c1-4-5(10)18-8-16-3-17-19(8)6(4)15-2-9(13,14)7(11)12/h3,7,15H,2H2,1H3 |
| InChIKey | MNKIWAJVMWNGCG-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 55.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.64 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|