C8H7ClF4N2O2S — CID 106293368
methyl 4-chloro-2-(2,2,3,3-tetrafluoropropylamino)-1,3-thiazole-5-carboxylate (PubChem CID 106293368) has the molecular formula C8H7ClF4N2O2S and a molecular weight of 306.67 g/mol. Its IUPAC name is methyl 4-chloro-2-(2,2,3,3-tetrafluoropropylamino)-1,3-thiazole-5-carboxylate.
| Compound Name | methyl 4-chloro-2-(2,2,3,3-tetrafluoropropylamino)-1,3-thiazole-5-carboxylate |
|---|---|
| PubChem CID | 106293368 |
| Molecular Formula | C8H7ClF4N2O2S |
| Molecular Weight | 306.67 g/mol |
| Exact Mass | 305.99 |
| IUPAC Name | methyl 4-chloro-2-(2,2,3,3-tetrafluoropropylamino)-1,3-thiazole-5-carboxylate |
| SMILES | COC(=O)c1sc(NCC(F)(F)C(F)F)nc1Cl |
| InChI | InChI=1S/C8H7ClF4N2O2S/c1-17-5(16)3-4(9)15-7(18-3)14-2-8(12,13)6(10)11/h6H,2H2,1H3,(H,14,15) |
| InChIKey | XQURCIUFCPRJLA-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.67 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|