C10H13F4N3O — CID 106293570
1-propyl-3-(2,2,3,3-tetrafluoropropylamino)pyrazin-2-one (PubChem CID 106293570) has the molecular formula C10H13F4N3O and a molecular weight of 267.23 g/mol. Its IUPAC name is 1-propyl-3-(2,2,3,3-tetrafluoropropylamino)pyrazin-2-one.
| Compound Name | 1-propyl-3-(2,2,3,3-tetrafluoropropylamino)pyrazin-2-one |
|---|---|
| PubChem CID | 106293570 |
| Molecular Formula | C10H13F4N3O |
| Molecular Weight | 267.23 g/mol |
| Exact Mass | 267.10 |
| IUPAC Name | 1-propyl-3-(2,2,3,3-tetrafluoropropylamino)pyrazin-2-one |
| SMILES | CCCn1ccnc(NCC(F)(F)C(F)F)c1=O |
| InChI | InChI=1S/C10H13F4N3O/c1-2-4-17-5-3-15-7(8(17)18)16-6-10(13,14)9(11)12/h3,5,9H,2,4,6H2,1H3,(H,15,16) |
| InChIKey | IZNDRYAXIZKARI-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.23 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|