C7H6F5N3 — CID 106293605
5-fluoro-N-(2,2,3,3-tetrafluoropropyl)pyrimidin-2-amine (PubChem CID 106293605) has the molecular formula C7H6F5N3 and a molecular weight of 227.14 g/mol. Its IUPAC name is 5-fluoro-N-(2,2,3,3-tetrafluoropropyl)pyrimidin-2-amine.
| Compound Name | 5-fluoro-N-(2,2,3,3-tetrafluoropropyl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 106293605 |
| Molecular Formula | C7H6F5N3 |
| Molecular Weight | 227.14 g/mol |
| Exact Mass | 227.05 |
| IUPAC Name | 5-fluoro-N-(2,2,3,3-tetrafluoropropyl)pyrimidin-2-amine |
| SMILES | Fc1cnc(NCC(F)(F)C(F)F)nc1 |
| InChI | InChI=1S/C7H6F5N3/c8-4-1-13-6(14-2-4)15-3-7(11,12)5(9)10/h1-2,5H,3H2,(H,13,14,15) |
| InChIKey | UGEZQKVOTSBKRD-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.14 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|