C7H9F4N3O2S — CID 106293627
5-methyl-N-(2,2,3,3-tetrafluoropropyl)-1H-pyrazole-4-sulfonamide (PubChem CID 106293627) has the molecular formula C7H9F4N3O2S and a molecular weight of 275.23 g/mol. Its IUPAC name is 5-methyl-N-(2,2,3,3-tetrafluoropropyl)-1H-pyrazole-4-sulfonamide.
| Compound Name | 5-methyl-N-(2,2,3,3-tetrafluoropropyl)-1H-pyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 106293627 |
| Molecular Formula | C7H9F4N3O2S |
| Molecular Weight | 275.23 g/mol |
| Exact Mass | 275.04 |
| IUPAC Name | 5-methyl-N-(2,2,3,3-tetrafluoropropyl)-1H-pyrazole-4-sulfonamide |
| SMILES | Cc1[nH]ncc1S(=O)(=O)NCC(F)(F)C(F)F |
| InChI | InChI=1S/C7H9F4N3O2S/c1-4-5(2-12-14-4)17(15,16)13-3-7(10,11)6(8)9/h2,6,13H,3H2,1H3,(H,12,14) |
| InChIKey | FCFFGIFIXHCFTA-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 74.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.23 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|